ChemNet > CAS > 374538-04-2 4-Cyclohexylbenzeneboronic acid
374538-04-2 4-Cyclohexylbenzeneboronic acid
| उत्पाद का नाम |
4-Cyclohexylbenzeneboronic acid |
| समानार्थी |
4-Cyclohexylphenylboronic acid |
| आणविक फार्मूला |
C12H17BO2 |
| आण्विक वजन |
204.0732 |
| InChI |
InChI=1/C12H17BO2/c14-13(15)12-8-6-11(7-9-12)10-4-2-1-3-5-10/h6-10,14-15H,1-5H2 |
| कैस रजिस्टी संख्या |
374538-04-2 |
| आणविक संरचना |
|
| घनत्व |
1.09g/cm3 |
| उबलने का समय |
363.7°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.543 |
| फ्लैश प्वाइंट |
173.8°C |
| खतरा प्रतीक |
|
| खतरे के कोड |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
